C24H26N2O3 — CID 124581051
(1R,9R,10R,17S)-N-(2,5-dimethylphenyl)-16-oxo-2-oxa-15-azatetracyclo[7.5.3.01,10.03,8]heptadeca-3,5,7-triene-17-carboxamide (PubChem CID 124581051) has the molecular formula C24H26N2O3 and a molecular weight of 390.48 g/mol. Its IUPAC name is (1R,9R,10R,17S)-N-(2,5-dimethylphenyl)-16-oxo-2-oxa-15-azatetracyclo[7.5.3.01,10.03,8]heptadeca-3,5,7-triene-17-carboxamide.
| Compound Name | (1R,9R,10R,17S)-N-(2,5-dimethylphenyl)-16-oxo-2-oxa-15-azatetracyclo[7.5.3.01,10.03,8]heptadeca-3,5,7-triene-17-carboxamide |
|---|---|
| PubChem CID | 124581051 |
| Molecular Formula | C24H26N2O3 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | (1R,9R,10R,17S)-N-(2,5-dimethylphenyl)-16-oxo-2-oxa-15-azatetracyclo[7.5.3.01,10.03,8]heptadeca-3,5,7-triene-17-carboxamide |
| SMILES | Cc1ccc(C)c(NC(=O)[C@H]2C(=O)N[C@@]34CCCC[C@@H]3[C@H]2c2ccccc2O4)c1 |
| InChI | InChI=1S/C24H26N2O3/c1-14-10-11-15(2)18(13-14)25-22(27)21-20-16-7-3-4-9-19(16)29-24(26-23(21)28)12-6-5-8-17(20)24/h3-4,7,9-11,13,17,20-21H,5-6,8,12H2,1-2H3,(H,25,27)(H,26,28)/t17-,20-,21+,24-/m1/s1 |
| InChIKey | VCNRGLNHTJJNCG-JWIQCUOBSA-N |
| XLogP | 4.05 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|