C24H26N2O4 — CID 124773060
(1R,9R,10R,18S)-N-(2-methoxyphenyl)-17-oxo-2-oxa-15-azatetracyclo[7.5.4.01,10.03,8]octadeca-3,5,7-triene-18-carboxamide (PubChem CID 124773060) has the molecular formula C24H26N2O4 and a molecular weight of 406.48 g/mol. Its IUPAC name is (1R,9R,10R,18S)-N-(2-methoxyphenyl)-17-oxo-2-oxa-15-azatetracyclo[7.5.4.01,10.03,8]octadeca-3,5,7-triene-18-carboxamide.
| Compound Name | (1R,9R,10R,18S)-N-(2-methoxyphenyl)-17-oxo-2-oxa-15-azatetracyclo[7.5.4.01,10.03,8]octadeca-3,5,7-triene-18-carboxamide |
|---|---|
| PubChem CID | 124773060 |
| Molecular Formula | C24H26N2O4 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | (1R,9R,10R,18S)-N-(2-methoxyphenyl)-17-oxo-2-oxa-15-azatetracyclo[7.5.4.01,10.03,8]octadeca-3,5,7-triene-18-carboxamide |
| SMILES | COc1ccccc1NC(=O)[C@@H]1C(=O)CN[C@@]23CCCC[C@@H]2[C@H]1c1ccccc1O3 |
| InChI | InChI=1S/C24H26N2O4/c1-29-20-12-5-3-10-17(20)26-23(28)22-18(27)14-25-24-13-7-6-9-16(24)21(22)15-8-2-4-11-19(15)30-24/h2-5,8,10-12,16,21-22,25H,6-7,9,13-14H2,1H3,(H,26,28)/t16-,21-,22-,24-/m1/s1 |
| InChIKey | ULEATJBIFMNAON-UMTYBPSHSA-N |
| XLogP | 3.48 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|