C27H29NO6 — CID 44509775
17-[(E)-3-(2,3,4-trimethoxyphenyl)prop-2-enoyl]-2-oxa-15-azatetracyclo[7.5.3.01,10.03,8]heptadeca-3,5,7-trien-16-one (PubChem CID 44509775) has the molecular formula C27H29NO6 and a molecular weight of 463.53 g/mol. Its IUPAC name is 17-[(E)-3-(2,3,4-trimethoxyphenyl)prop-2-enoyl]-2-oxa-15-azatetracyclo[7.5.3.01,10.03,8]heptadeca-3,5,7-trien-16-one.
| Compound Name | 17-[(E)-3-(2,3,4-trimethoxyphenyl)prop-2-enoyl]-2-oxa-15-azatetracyclo[7.5.3.01,10.03,8]heptadeca-3,5,7-trien-16-one |
|---|---|
| PubChem CID | 44509775 |
| Molecular Formula | C27H29NO6 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | 17-[(E)-3-(2,3,4-trimethoxyphenyl)prop-2-enoyl]-2-oxa-15-azatetracyclo[7.5.3.01,10.03,8]heptadeca-3,5,7-trien-16-one |
| SMILES | COc1ccc(/C=C/C(=O)C2C(=O)NC34CCCCC3C2c2ccccc2O4)c(OC)c1OC |
| InChI | InChI=1S/C27H29NO6/c1-31-21-14-12-16(24(32-2)25(21)33-3)11-13-19(29)23-22-17-8-4-5-10-20(17)34-27(28-26(23)30)15-7-6-9-18(22)27/h4-5,8,10-14,18,22-23H,6-7,9,15H2,1-3H3,(H,28,30)/b13-11+ |
| InChIKey | WQCRFCLGTXGPFY-ACCUITESSA-N |
| XLogP | 4.10 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|