C23H24N2O4 — CID 4096279
17-benzoyl-5-methoxy-12-methyl-2-oxa-12,15-diazatetracyclo[7.5.3.01,10.03,8]heptadeca-3(8),4,6-trien-16-one (PubChem CID 4096279) has the molecular formula C23H24N2O4 and a molecular weight of 392.46 g/mol. Its IUPAC name is 17-benzoyl-5-methoxy-12-methyl-2-oxa-12,15-diazatetracyclo[7.5.3.01,10.03,8]heptadeca-3(8),4,6-trien-16-one.
| Compound Name | 17-benzoyl-5-methoxy-12-methyl-2-oxa-12,15-diazatetracyclo[7.5.3.01,10.03,8]heptadeca-3(8),4,6-trien-16-one |
|---|---|
| PubChem CID | 4096279 |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 17-benzoyl-5-methoxy-12-methyl-2-oxa-12,15-diazatetracyclo[7.5.3.01,10.03,8]heptadeca-3(8),4,6-trien-16-one |
| SMILES | COc1ccc2c(c1)OC13CCN(C)CC1C2C(C(=O)c1ccccc1)C(=O)N3 |
| InChI | InChI=1S/C23H24N2O4/c1-25-11-10-23-17(13-25)19(16-9-8-15(28-2)12-18(16)29-23)20(22(27)24-23)21(26)14-6-4-3-5-7-14/h3-9,12,17,19-20H,10-11,13H2,1-2H3,(H,24,27) |
| InChIKey | YWRRQPCLDKTTJT-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|