C27H29NO5 — CID 54735530
(17Z)-17-[(E)-3-(4-ethoxy-3-methoxyphenyl)-1-hydroxyprop-2-enylidene]-2-oxa-15-azatetracyclo[7.5.3.01,10.03,8]heptadeca-3,5,7-trien-16-one (PubChem CID 54735530) has the molecular formula C27H29NO5 and a molecular weight of 447.53 g/mol. Its IUPAC name is (17Z)-17-[(E)-3-(4-ethoxy-3-methoxyphenyl)-1-hydroxyprop-2-enylidene]-2-oxa-15-azatetracyclo[7.5.3.01,10.03,8]heptadeca-3,5,7-trien-16-one.
| Compound Name | (17Z)-17-[(E)-3-(4-ethoxy-3-methoxyphenyl)-1-hydroxyprop-2-enylidene]-2-oxa-15-azatetracyclo[7.5.3.01,10.03,8]heptadeca-3,5,7-trien-16-one |
|---|---|
| PubChem CID | 54735530 |
| Molecular Formula | C27H29NO5 |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | (17Z)-17-[(E)-3-(4-ethoxy-3-methoxyphenyl)-1-hydroxyprop-2-enylidene]-2-oxa-15-azatetracyclo[7.5.3.01,10.03,8]heptadeca-3,5,7-trien-16-one |
| SMILES | CCOc1ccc(/C=C/C(O)=C2/C(=O)NC34CCCCC3C2c2ccccc2O4)cc1OC |
| InChI | InChI=1S/C27H29NO5/c1-3-32-22-14-12-17(16-23(22)31-2)11-13-20(29)25-24-18-8-4-5-10-21(18)33-27(28-26(25)30)15-7-6-9-19(24)27/h4-5,8,10-14,16,19,24,29H,3,6-7,9,15H2,1-2H3,(H,28,30)/b13-11+,25-20- |
| InChIKey | MHJMVWUPADBEIL-CWRPQIOQSA-N |
| XLogP | 5.11 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|