C18H22O3 — CID 164673284
1-[(2R,3'aR,4R,7'aS)-spiro[3,4-dihydrochromene-2,3'-3a,4,5,6,7,7a-hexahydro-1H-2-benzofuran]-4-yl]ethanone (PubChem CID 164673284) has the molecular formula C18H22O3 and a molecular weight of 286.37 g/mol. Its IUPAC name is 1-[(2R,3'aR,4R,7'aS)-spiro[3,4-dihydrochromene-2,3'-3a,4,5,6,7,7a-hexahydro-1H-2-benzofuran]-4-yl]ethanone.
| Compound Name | 1-[(2R,3'aR,4R,7'aS)-spiro[3,4-dihydrochromene-2,3'-3a,4,5,6,7,7a-hexahydro-1H-2-benzofuran]-4-yl]ethanone |
|---|---|
| PubChem CID | 164673284 |
| Molecular Formula | C18H22O3 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | 1-[(2R,3'aR,4R,7'aS)-spiro[3,4-dihydrochromene-2,3'-3a,4,5,6,7,7a-hexahydro-1H-2-benzofuran]-4-yl]ethanone |
| SMILES | CC(=O)[C@@H]1C[C@@]2(OC[C@H]3CCCC[C@H]32)Oc2ccccc21 |
| InChI | InChI=1S/C18H22O3/c1-12(19)15-10-18(21-17-9-5-3-7-14(15)17)16-8-4-2-6-13(16)11-20-18/h3,5,7,9,13,15-16H,2,4,6,8,10-11H2,1H3/t13-,15+,16-,18-/m1/s1 |
| InChIKey | KTLCWRMHWXUDFR-NOVWEMISSA-N |
| XLogP | 3.67 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |