C13H14N2OS — CID 100822502
(1R,9R,10S)-2-oxa-14,16-diazatetracyclo[7.4.3.01,10.03,8]hexadeca-3,5,7-triene-15-thione (PubChem CID 100822502) has the molecular formula C13H14N2OS and a molecular weight of 246.33 g/mol. Its IUPAC name is (1R,9R,10S)-2-oxa-14,16-diazatetracyclo[7.4.3.01,10.03,8]hexadeca-3,5,7-triene-15-thione.
| Compound Name | (1R,9R,10S)-2-oxa-14,16-diazatetracyclo[7.4.3.01,10.03,8]hexadeca-3,5,7-triene-15-thione |
|---|---|
| PubChem CID | 100822502 |
| Molecular Formula | C13H14N2OS |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | (1R,9R,10S)-2-oxa-14,16-diazatetracyclo[7.4.3.01,10.03,8]hexadeca-3,5,7-triene-15-thione |
| SMILES | S=C1N[C@H]2c3ccccc3O[C@@]3(CCC[C@@H]23)N1 |
| InChI | InChI=1S/C13H14N2OS/c17-12-14-11-8-4-1-2-6-10(8)16-13(15-12)7-3-5-9(11)13/h1-2,4,6,9,11H,3,5,7H2,(H2,14,15,17)/t9-,11-,13+/m0/s1 |
| InChIKey | YXZRFJLFCAQZSY-XHVZSJERSA-N |
| XLogP | 2.09 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|