C27H25ClN2O2S — CID 98398283
(1S,9S,10S,14R,15R)-6-chloro-5-hydroxy-9,15-diphenyl-2-oxa-16,18-diazatetracyclo[8.8.0.01,14.03,8]octadeca-3,5,7-triene-17-thione (PubChem CID 98398283) has the molecular formula C27H25ClN2O2S and a molecular weight of 477.03 g/mol. Its IUPAC name is (1S,9S,10S,14R,15R)-6-chloro-5-hydroxy-9,15-diphenyl-2-oxa-16,18-diazatetracyclo[8.8.0.01,14.03,8]octadeca-3,5,7-triene-17-thione.
| Compound Name | (1S,9S,10S,14R,15R)-6-chloro-5-hydroxy-9,15-diphenyl-2-oxa-16,18-diazatetracyclo[8.8.0.01,14.03,8]octadeca-3,5,7-triene-17-thione |
|---|---|
| PubChem CID | 98398283 |
| Molecular Formula | C27H25ClN2O2S |
| Molecular Weight | 477.03 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | (1S,9S,10S,14R,15R)-6-chloro-5-hydroxy-9,15-diphenyl-2-oxa-16,18-diazatetracyclo[8.8.0.01,14.03,8]octadeca-3,5,7-triene-17-thione |
| SMILES | Oc1cc2c(cc1Cl)[C@H](c1ccccc1)[C@@H]1CCC[C@@H]3[C@H](c4ccccc4)NC(=S)N[C@@]31O2 |
| InChI | InChI=1S/C27H25ClN2O2S/c28-21-14-18-23(15-22(21)31)32-27-19(24(18)16-8-3-1-4-9-16)12-7-13-20(27)25(29-26(33)30-27)17-10-5-2-6-11-17/h1-6,8-11,14-15,19-20,24-25,31H,7,12-13H2,(H2,29,30,33)/t19-,20+,24-,25-,27-/m0/s1 |
| InChIKey | OJVFCCKMQFSLLN-VODJCNEOSA-N |
| XLogP | 5.90 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.03 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|