C29H30N2O5S — CID 51421541
(1R,9S,10R,14R,15R)-4,5-dihydroxy-9,15-bis(4-methoxyphenyl)-2-oxa-16,18-diazatetracyclo[8.8.0.01,14.03,8]octadeca-3(8),4,6-triene-17-thione (PubChem CID 51421541) has the molecular formula C29H30N2O5S and a molecular weight of 518.64 g/mol. Its IUPAC name is (1R,9S,10R,14R,15R)-4,5-dihydroxy-9,15-bis(4-methoxyphenyl)-2-oxa-16,18-diazatetracyclo[8.8.0.01,14.03,8]octadeca-3(8),4,6-triene-17-thione.
| Compound Name | (1R,9S,10R,14R,15R)-4,5-dihydroxy-9,15-bis(4-methoxyphenyl)-2-oxa-16,18-diazatetracyclo[8.8.0.01,14.03,8]octadeca-3(8),4,6-triene-17-thione |
|---|---|
| PubChem CID | 51421541 |
| Molecular Formula | C29H30N2O5S |
| Molecular Weight | 518.64 g/mol |
| Exact Mass | 518.19 |
| IUPAC Name | (1R,9S,10R,14R,15R)-4,5-dihydroxy-9,15-bis(4-methoxyphenyl)-2-oxa-16,18-diazatetracyclo[8.8.0.01,14.03,8]octadeca-3(8),4,6-triene-17-thione |
| SMILES | COc1ccc([C@H]2c3ccc(O)c(O)c3O[C@@]34NC(=S)N[C@@H](c5ccc(OC)cc5)[C@H]3CCC[C@H]24)cc1 |
| InChI | InChI=1S/C29H30N2O5S/c1-34-18-10-6-16(7-11-18)24-20-14-15-23(32)26(33)27(20)36-29-21(24)4-3-5-22(29)25(30-28(37)31-29)17-8-12-19(35-2)13-9-17/h6-15,21-22,24-25,32-33H,3-5H2,1-2H3,(H2,30,31,37)/t21-,22-,24+,25+,29-/m1/s1 |
| InChIKey | ISPSPYAXVKKUQA-XNIAFWOFSA-N |
| XLogP | 4.97 |
| TPSA | 92.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.64 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|