C17H18ClNO2 — CID 10685891
(2R)-2-[(benzylamino)methyl]-6-chloro-3,4-dihydro-2H-chromen-7-ol (PubChem CID 10685891) has the molecular formula C17H18ClNO2 and a molecular weight of 303.79 g/mol. Its IUPAC name is (2R)-2-[(benzylamino)methyl]-6-chloro-3,4-dihydro-2H-chromen-7-ol.
| Compound Name | (2R)-2-[(benzylamino)methyl]-6-chloro-3,4-dihydro-2H-chromen-7-ol |
|---|---|
| PubChem CID | 10685891 |
| Molecular Formula | C17H18ClNO2 |
| Molecular Weight | 303.79 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | (2R)-2-[(benzylamino)methyl]-6-chloro-3,4-dihydro-2H-chromen-7-ol |
| SMILES | Oc1cc2c(cc1Cl)CC[C@H](CNCc1ccccc1)O2 |
| InChI | InChI=1S/C17H18ClNO2/c18-15-8-13-6-7-14(21-17(13)9-16(15)20)11-19-10-12-4-2-1-3-5-12/h1-5,8-9,14,19-20H,6-7,10-11H2/t14-/m1/s1 |
| InChIKey | BCTPODDQZONFKA-CQSZACIVSA-N |
| XLogP | 3.53 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.79 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |