C19H20N2O — CID 10062927
N-benzyl-1-(2,3,4,7-tetrahydropyrano[2,3-e]indol-2-yl)methanamine (PubChem CID 10062927) has the molecular formula C19H20N2O and a molecular weight of 292.38 g/mol. Its IUPAC name is N-benzyl-1-(2,3,4,7-tetrahydropyrano[2,3-e]indol-2-yl)methanamine.
| Compound Name | N-benzyl-1-(2,3,4,7-tetrahydropyrano[2,3-e]indol-2-yl)methanamine |
|---|---|
| PubChem CID | 10062927 |
| Molecular Formula | C19H20N2O |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | N-benzyl-1-(2,3,4,7-tetrahydropyrano[2,3-e]indol-2-yl)methanamine |
| SMILES | c1ccc(CNCC2CCc3ccc4[nH]ccc4c3O2)cc1 |
| InChI | InChI=1S/C19H20N2O/c1-2-4-14(5-3-1)12-20-13-16-8-6-15-7-9-18-17(10-11-21-18)19(15)22-16/h1-5,7,9-11,16,20-21H,6,8,12-13H2 |
| InChIKey | AERWLNZHDGJKMO-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 37.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |