C15H19NO — CID 98159599
(1R,9R,10R)-2-oxa-17-azatetracyclo[7.5.3.01,10.03,8]heptadeca-3,5,7-triene (PubChem CID 98159599) has the molecular formula C15H19NO and a molecular weight of 229.32 g/mol. Its IUPAC name is (1R,9R,10R)-2-oxa-17-azatetracyclo[7.5.3.01,10.03,8]heptadeca-3,5,7-triene.
| Compound Name | (1R,9R,10R)-2-oxa-17-azatetracyclo[7.5.3.01,10.03,8]heptadeca-3,5,7-triene |
|---|---|
| PubChem CID | 98159599 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | (1R,9R,10R)-2-oxa-17-azatetracyclo[7.5.3.01,10.03,8]heptadeca-3,5,7-triene |
| SMILES | c1ccc2c(c1)O[C@@]13CCCC[C@@H]1[C@H]2NCC3 |
| InChI | InChI=1S/C15H19NO/c1-2-7-13-11(5-1)14-12-6-3-4-8-15(12,17-13)9-10-16-14/h1-2,5,7,12,14,16H,3-4,6,8-10H2/t12-,14+,15-/m1/s1 |
| InChIKey | KCYFTAPCHLTSLC-VHDGCEQUSA-N |
| XLogP | 3.04 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |