C11H10N2O2S — CID 134812916
9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-13-one (PubChem CID 134812916) has the molecular formula C11H10N2O2S and a molecular weight of 234.28 g/mol. Its IUPAC name is 9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-13-one.
| Compound Name | 9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-13-one |
|---|---|
| PubChem CID | 134812916 |
| Molecular Formula | C11H10N2O2S |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | 9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-13-one |
| SMILES | CC12NC(=S)NC(C1=O)c1ccccc1O2 |
| InChI | InChI=1S/C11H10N2O2S/c1-11-9(14)8(12-10(16)13-11)6-4-2-3-5-7(6)15-11/h2-5,8H,1H3,(H2,12,13,16) |
| InChIKey | LLWDSGXKUZCHNI-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|