C24H22ClNO3 — CID 98668327
(1R,9R,10R,17Z)-17-[(E)-3-(4-chlorophenyl)-1-hydroxyprop-2-enylidene]-2-oxa-15-azatetracyclo[7.5.3.01,10.03,8]heptadeca-3,5,7-trien-16-one (PubChem CID 98668327) has the molecular formula C24H22ClNO3 and a molecular weight of 407.90 g/mol. Its IUPAC name is (1R,9R,10R,17Z)-17-[(E)-3-(4-chlorophenyl)-1-hydroxyprop-2-enylidene]-2-oxa-15-azatetracyclo[7.5.3.01,10.03,8]heptadeca-3,5,7-trien-16-one.
| Compound Name | (1R,9R,10R,17Z)-17-[(E)-3-(4-chlorophenyl)-1-hydroxyprop-2-enylidene]-2-oxa-15-azatetracyclo[7.5.3.01,10.03,8]heptadeca-3,5,7-trien-16-one |
|---|---|
| PubChem CID | 98668327 |
| Molecular Formula | C24H22ClNO3 |
| Molecular Weight | 407.90 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | (1R,9R,10R,17Z)-17-[(E)-3-(4-chlorophenyl)-1-hydroxyprop-2-enylidene]-2-oxa-15-azatetracyclo[7.5.3.01,10.03,8]heptadeca-3,5,7-trien-16-one |
| SMILES | O=C1N[C@@]23CCCC[C@@H]2[C@@H](/C1=C(O)\C=C\c1ccc(Cl)cc1)c1ccccc1O3 |
| InChI | InChI=1S/C24H22ClNO3/c25-16-11-8-15(9-12-16)10-13-19(27)22-21-17-5-1-2-7-20(17)29-24(26-23(22)28)14-4-3-6-18(21)24/h1-2,5,7-13,18,21,27H,3-4,6,14H2,(H,26,28)/b13-10+,22-19-/t18-,21+,24-/m1/s1 |
| InChIKey | JVJWLARJLKCNHI-SVVSIZISSA-N |
| XLogP | 5.36 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.90 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|