C18H21NO4 — CID 54711717
(17Z)-17-(1-hydroxyethylidene)-4-methoxy-2-oxa-15-azatetracyclo[7.5.3.01,10.03,8]heptadeca-3(8),4,6-trien-16-one (PubChem CID 54711717) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is (17Z)-17-(1-hydroxyethylidene)-4-methoxy-2-oxa-15-azatetracyclo[7.5.3.01,10.03,8]heptadeca-3(8),4,6-trien-16-one.
| Compound Name | (17Z)-17-(1-hydroxyethylidene)-4-methoxy-2-oxa-15-azatetracyclo[7.5.3.01,10.03,8]heptadeca-3(8),4,6-trien-16-one |
|---|---|
| PubChem CID | 54711717 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | (17Z)-17-(1-hydroxyethylidene)-4-methoxy-2-oxa-15-azatetracyclo[7.5.3.01,10.03,8]heptadeca-3(8),4,6-trien-16-one |
| SMILES | COc1cccc2c1OC13CCCCC1C2/C(=C(\C)O)C(=O)N3 |
| InChI | InChI=1S/C18H21NO4/c1-10(20)14-15-11-6-5-8-13(22-2)16(11)23-18(19-17(14)21)9-4-3-7-12(15)18/h5-6,8,12,15,20H,3-4,7,9H2,1-2H3,(H,19,21)/b14-10- |
| InChIKey | WLDMZPDBLINPTD-UVTDQMKNSA-N |
| XLogP | 3.02 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|