C19H27N2O5+ — CID 11889247
4-[(4aR,9S,9aS)-5-methoxy-9-(nitromethyl)-1,2,3,4,9,9a-hexahydroxanthen-4a-yl]morpholin-4-ium (PubChem CID 11889247) has the molecular formula C19H27N2O5+ and a molecular weight of 363.43 g/mol. Its IUPAC name is 4-[(4aR,9S,9aS)-5-methoxy-9-(nitromethyl)-1,2,3,4,9,9a-hexahydroxanthen-4a-yl]morpholin-4-ium.
| Compound Name | 4-[(4aR,9S,9aS)-5-methoxy-9-(nitromethyl)-1,2,3,4,9,9a-hexahydroxanthen-4a-yl]morpholin-4-ium |
|---|---|
| PubChem CID | 11889247 |
| Molecular Formula | C19H27N2O5+ |
| Molecular Weight | 363.43 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | 4-[(4aR,9S,9aS)-5-methoxy-9-(nitromethyl)-1,2,3,4,9,9a-hexahydroxanthen-4a-yl]morpholin-4-ium |
| SMILES | COc1cccc2c1O[C@]1([NH+]3CCOCC3)CCCC[C@H]1[C@@H]2C[N+](=O)[O-] |
| InChI | InChI=1S/C19H26N2O5/c1-24-17-7-4-5-14-15(13-21(22)23)16-6-2-3-8-19(16,26-18(14)17)20-9-11-25-12-10-20/h4-5,7,15-16H,2-3,6,8-13H2,1H3/p+1/t15-,16+,19-/m1/s1 |
| InChIKey | WZXCWLCTYQZXIV-JTDSTZFVSA-O |
| XLogP | 1.25 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.43 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|