C19H26N2O4 — CID 110143933
1-[(4aS,10bS)-7-methoxyspiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine]-1'-yl]-2-aminoethanone (PubChem CID 110143933) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is 1-[(4aS,10bS)-7-methoxyspiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine]-1'-yl]-2-aminoethanone.
| Compound Name | 1-[(4aS,10bS)-7-methoxyspiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine]-1'-yl]-2-aminoethanone |
|---|---|
| PubChem CID | 110143933 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 1-[(4aS,10bS)-7-methoxyspiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine]-1'-yl]-2-aminoethanone |
| SMILES | COc1cccc2c1OC1(CCN(C(=O)CN)CC1)[C@H]1CCCO[C@H]21 |
| InChI | InChI=1S/C19H26N2O4/c1-23-15-6-2-4-13-17-14(5-3-11-24-17)19(25-18(13)15)7-9-21(10-8-19)16(22)12-20/h2,4,6,14,17H,3,5,7-12,20H2,1H3/t14-,17+/m0/s1 |
| InChIKey | NYCSPMVYMZVJTJ-WMLDXEAASA-N |
| XLogP | 1.88 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |