C23H29ClN2O4 — CID 110144293
1-[3-[(4aS,10bS)-9-chlorospiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine]-1'-yl]-3-oxopropyl]pyrrolidin-2-one (PubChem CID 110144293) has the molecular formula C23H29ClN2O4 and a molecular weight of 432.95 g/mol. Its IUPAC name is 1-[3-[(4aS,10bS)-9-chlorospiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine]-1'-yl]-3-oxopropyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[(4aS,10bS)-9-chlorospiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine]-1'-yl]-3-oxopropyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 110144293 |
| Molecular Formula | C23H29ClN2O4 |
| Molecular Weight | 432.95 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | 1-[3-[(4aS,10bS)-9-chlorospiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine]-1'-yl]-3-oxopropyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1CCC(=O)N1CCC2(CC1)Oc1ccc(Cl)cc1[C@H]1OCCC[C@@H]12 |
| InChI | InChI=1S/C23H29ClN2O4/c24-16-5-6-19-17(15-16)22-18(3-2-14-29-22)23(30-19)8-12-26(13-9-23)21(28)7-11-25-10-1-4-20(25)27/h5-6,15,18,22H,1-4,7-14H2/t18-,22+/m0/s1 |
| InChIKey | NUOFOAYMIUEAKY-PGRDOPGGSA-N |
| XLogP | 3.57 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.95 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |