C23H23ClFNO3 — CID 110144070
[(4aS,10bS)-9-chlorospiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine]-1'-yl]-(4-fluorophenyl)methanone (PubChem CID 110144070) has the molecular formula C23H23ClFNO3 and a molecular weight of 415.89 g/mol. Its IUPAC name is [(4aS,10bS)-9-chlorospiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine]-1'-yl]-(4-fluorophenyl)methanone.
| Compound Name | [(4aS,10bS)-9-chlorospiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine]-1'-yl]-(4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 110144070 |
| Molecular Formula | C23H23ClFNO3 |
| Molecular Weight | 415.89 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | [(4aS,10bS)-9-chlorospiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine]-1'-yl]-(4-fluorophenyl)methanone |
| SMILES | O=C(c1ccc(F)cc1)N1CCC2(CC1)Oc1ccc(Cl)cc1[C@H]1OCCC[C@@H]12 |
| InChI | InChI=1S/C23H23ClFNO3/c24-16-5-8-20-18(14-16)21-19(2-1-13-28-21)23(29-20)9-11-26(12-10-23)22(27)15-3-6-17(25)7-4-15/h3-8,14,19,21H,1-2,9-13H2/t19-,21+/m0/s1 |
| InChIKey | BQYSVVDJMOPHIO-PZJWPPBQSA-N |
| XLogP | 5.01 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.89 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |