C23H25ClN2O3 — CID 110144053
1-[(4aS,10bS)-9-chlorospiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine]-1'-yl]-2-pyridin-3-ylethanone (PubChem CID 110144053) has the molecular formula C23H25ClN2O3 and a molecular weight of 412.92 g/mol. Its IUPAC name is 1-[(4aS,10bS)-9-chlorospiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine]-1'-yl]-2-pyridin-3-ylethanone.
| Compound Name | 1-[(4aS,10bS)-9-chlorospiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine]-1'-yl]-2-pyridin-3-ylethanone |
|---|---|
| PubChem CID | 110144053 |
| Molecular Formula | C23H25ClN2O3 |
| Molecular Weight | 412.92 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 1-[(4aS,10bS)-9-chlorospiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine]-1'-yl]-2-pyridin-3-ylethanone |
| SMILES | O=C(Cc1cccnc1)N1CCC2(CC1)Oc1ccc(Cl)cc1[C@H]1OCCC[C@@H]12 |
| InChI | InChI=1S/C23H25ClN2O3/c24-17-5-6-20-18(14-17)22-19(4-2-12-28-22)23(29-20)7-10-26(11-8-23)21(27)13-16-3-1-9-25-15-16/h1,3,5-6,9,14-15,19,22H,2,4,7-8,10-13H2/t19-,22+/m0/s1 |
| InChIKey | SKIMGTSWAHXFNV-SIKLNZKXSA-N |
| XLogP | 4.20 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.92 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |