C21H26ClN3O2 — CID 155984228
(4aS,10bS)-9-chloro-1'-[(2-methylpyrazol-3-yl)methyl]spiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine] (PubChem CID 155984228) has the molecular formula C21H26ClN3O2 and a molecular weight of 387.91 g/mol. Its IUPAC name is (4aS,10bS)-9-chloro-1'-[(2-methylpyrazol-3-yl)methyl]spiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine].
| Compound Name | (4aS,10bS)-9-chloro-1'-[(2-methylpyrazol-3-yl)methyl]spiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine] |
|---|---|
| PubChem CID | 155984228 |
| Molecular Formula | C21H26ClN3O2 |
| Molecular Weight | 387.91 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | (4aS,10bS)-9-chloro-1'-[(2-methylpyrazol-3-yl)methyl]spiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine] |
| SMILES | Cn1nccc1CN1CCC2(CC1)Oc1ccc(Cl)cc1[C@H]1OCCC[C@@H]12 |
| InChI | InChI=1S/C21H26ClN3O2/c1-24-16(6-9-23-24)14-25-10-7-21(8-11-25)18-3-2-12-26-20(18)17-13-15(22)4-5-19(17)27-21/h4-6,9,13,18,20H,2-3,7-8,10-12,14H2,1H3/t18-,20+/m0/s1 |
| InChIKey | NDMRKYLZNORXDW-AZUAARDMSA-N |
| XLogP | 3.97 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.91 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |