C22H29N3O2 — CID 110143974
(4aS,10bS)-8-methyl-1'-[(2-methylpyrazol-3-yl)methyl]spiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine] (PubChem CID 110143974) has the molecular formula C22H29N3O2 and a molecular weight of 367.49 g/mol. Its IUPAC name is (4aS,10bS)-8-methyl-1'-[(2-methylpyrazol-3-yl)methyl]spiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine].
| Compound Name | (4aS,10bS)-8-methyl-1'-[(2-methylpyrazol-3-yl)methyl]spiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine] |
|---|---|
| PubChem CID | 110143974 |
| Molecular Formula | C22H29N3O2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | (4aS,10bS)-8-methyl-1'-[(2-methylpyrazol-3-yl)methyl]spiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine] |
| SMILES | Cc1ccc2c(c1)OC1(CCN(Cc3ccnn3C)CC1)[C@H]1CCCO[C@H]21 |
| InChI | InChI=1S/C22H29N3O2/c1-16-5-6-18-20(14-16)27-22(19-4-3-13-26-21(18)19)8-11-25(12-9-22)15-17-7-10-23-24(17)2/h5-7,10,14,19,21H,3-4,8-9,11-13,15H2,1-2H3/t19-,21+/m0/s1 |
| InChIKey | WAOSUXKYOJFKIF-PZJWPPBQSA-N |
| XLogP | 3.62 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |