C21H26N2O3S — CID 110144046
(4aS,10bS)-1'-[(4-methyl-1,3-thiazol-5-yl)methyl]spiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine]-7-ol (PubChem CID 110144046) has the molecular formula C21H26N2O3S and a molecular weight of 386.52 g/mol. Its IUPAC name is (4aS,10bS)-1'-[(4-methyl-1,3-thiazol-5-yl)methyl]spiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine]-7-ol.
| Compound Name | (4aS,10bS)-1'-[(4-methyl-1,3-thiazol-5-yl)methyl]spiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine]-7-ol |
|---|---|
| PubChem CID | 110144046 |
| Molecular Formula | C21H26N2O3S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | (4aS,10bS)-1'-[(4-methyl-1,3-thiazol-5-yl)methyl]spiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine]-7-ol |
| SMILES | Cc1ncsc1CN1CCC2(CC1)Oc1c(O)cccc1[C@H]1OCCC[C@@H]12 |
| InChI | InChI=1S/C21H26N2O3S/c1-14-18(27-13-22-14)12-23-9-7-21(8-10-23)16-5-3-11-25-19(16)15-4-2-6-17(24)20(15)26-21/h2,4,6,13,16,19,24H,3,5,7-12H2,1H3/t16-,19+/m0/s1 |
| InChIKey | QGPDTVRBNVBKNL-QFBILLFUSA-N |
| XLogP | 4.05 |
| TPSA | 54.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |