C25H34N2O4 — CID 110144149
1-[4-[(4aS,10bS)-8-methylspiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine]-1'-carbonyl]piperidin-1-yl]ethanone (PubChem CID 110144149) has the molecular formula C25H34N2O4 and a molecular weight of 426.56 g/mol. Its IUPAC name is 1-[4-[(4aS,10bS)-8-methylspiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine]-1'-carbonyl]piperidin-1-yl]ethanone.
| Compound Name | 1-[4-[(4aS,10bS)-8-methylspiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine]-1'-carbonyl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 110144149 |
| Molecular Formula | C25H34N2O4 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | 1-[4-[(4aS,10bS)-8-methylspiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine]-1'-carbonyl]piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC(C(=O)N2CCC3(CC2)Oc2cc(C)ccc2[C@H]2OCCC[C@@H]23)CC1 |
| InChI | InChI=1S/C25H34N2O4/c1-17-5-6-20-22(16-17)31-25(21-4-3-15-30-23(20)21)9-13-27(14-10-25)24(29)19-7-11-26(12-8-19)18(2)28/h5-6,16,19,21,23H,3-4,7-15H2,1-2H3/t21-,23+/m0/s1 |
| InChIKey | ASWLCVKFIKQEBW-JTHBVZDNSA-N |
| XLogP | 3.47 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |