C25H29NO4 — CID 110144101
[(4aS,10bS)-8-methylspiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine]-1'-yl]-(3-methoxyphenyl)methanone (PubChem CID 110144101) has the molecular formula C25H29NO4 and a molecular weight of 407.51 g/mol. Its IUPAC name is [(4aS,10bS)-8-methylspiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine]-1'-yl]-(3-methoxyphenyl)methanone.
| Compound Name | [(4aS,10bS)-8-methylspiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine]-1'-yl]-(3-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 110144101 |
| Molecular Formula | C25H29NO4 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | [(4aS,10bS)-8-methylspiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine]-1'-yl]-(3-methoxyphenyl)methanone |
| SMILES | COc1cccc(C(=O)N2CCC3(CC2)Oc2cc(C)ccc2[C@H]2OCCC[C@@H]23)c1 |
| InChI | InChI=1S/C25H29NO4/c1-17-8-9-20-22(15-17)30-25(21-7-4-14-29-23(20)21)10-12-26(13-11-25)24(27)18-5-3-6-19(16-18)28-2/h3,5-6,8-9,15-16,21,23H,4,7,10-14H2,1-2H3/t21-,23+/m0/s1 |
| InChIKey | BAQUMAJKFCUOKX-JTHBVZDNSA-N |
| XLogP | 4.54 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |