C25H29NO5 — CID 110144140
[(4aS,10bS)-7-hydroxyspiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine]-1'-yl]-[3-(methoxymethyl)phenyl]methanone (PubChem CID 110144140) has the molecular formula C25H29NO5 and a molecular weight of 423.51 g/mol. Its IUPAC name is [(4aS,10bS)-7-hydroxyspiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine]-1'-yl]-[3-(methoxymethyl)phenyl]methanone.
| Compound Name | [(4aS,10bS)-7-hydroxyspiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine]-1'-yl]-[3-(methoxymethyl)phenyl]methanone |
|---|---|
| PubChem CID | 110144140 |
| Molecular Formula | C25H29NO5 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | [(4aS,10bS)-7-hydroxyspiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine]-1'-yl]-[3-(methoxymethyl)phenyl]methanone |
| SMILES | COCc1cccc(C(=O)N2CCC3(CC2)Oc2c(O)cccc2[C@H]2OCCC[C@@H]23)c1 |
| InChI | InChI=1S/C25H29NO5/c1-29-16-17-5-2-6-18(15-17)24(28)26-12-10-25(11-13-26)20-8-4-14-30-22(20)19-7-3-9-21(27)23(19)31-25/h2-3,5-7,9,15,20,22,27H,4,8,10-14,16H2,1H3/t20-,22+/m0/s1 |
| InChIKey | DWUYPPDFTDNNLZ-RBBKRZOGSA-N |
| XLogP | 4.07 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |