C18H26N2O5S — CID 110144024
(4aS,10bS)-7-hydroxy-N,N-dimethylspiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine]-1'-sulfonamide (PubChem CID 110144024) has the molecular formula C18H26N2O5S and a molecular weight of 382.48 g/mol. Its IUPAC name is (4aS,10bS)-7-hydroxy-N,N-dimethylspiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine]-1'-sulfonamide.
| Compound Name | (4aS,10bS)-7-hydroxy-N,N-dimethylspiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine]-1'-sulfonamide |
|---|---|
| PubChem CID | 110144024 |
| Molecular Formula | C18H26N2O5S |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | (4aS,10bS)-7-hydroxy-N,N-dimethylspiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine]-1'-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CCC2(CC1)Oc1c(O)cccc1[C@H]1OCCC[C@@H]12 |
| InChI | InChI=1S/C18H26N2O5S/c1-19(2)26(22,23)20-10-8-18(9-11-20)14-6-4-12-24-16(14)13-5-3-7-15(21)17(13)25-18/h3,5,7,14,16,21H,4,6,8-12H2,1-2H3/t14-,16+/m0/s1 |
| InChIKey | ILIOELFYMPUQGC-GOEBONIOSA-N |
| XLogP | 1.89 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |