C20H28N2O6S — CID 110144108
N-[2-[(4aS,10bS)-7-methoxyspiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine]-1'-yl]-2-oxoethyl]methanesulfonamide (PubChem CID 110144108) has the molecular formula C20H28N2O6S and a molecular weight of 424.52 g/mol. Its IUPAC name is N-[2-[(4aS,10bS)-7-methoxyspiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine]-1'-yl]-2-oxoethyl]methanesulfonamide.
| Compound Name | N-[2-[(4aS,10bS)-7-methoxyspiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine]-1'-yl]-2-oxoethyl]methanesulfonamide |
|---|---|
| PubChem CID | 110144108 |
| Molecular Formula | C20H28N2O6S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | N-[2-[(4aS,10bS)-7-methoxyspiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine]-1'-yl]-2-oxoethyl]methanesulfonamide |
| SMILES | COc1cccc2c1OC1(CCN(C(=O)CNS(C)(=O)=O)CC1)[C@H]1CCCO[C@H]21 |
| InChI | InChI=1S/C20H28N2O6S/c1-26-16-7-3-5-14-18-15(6-4-12-27-18)20(28-19(14)16)8-10-22(11-9-20)17(23)13-21-29(2,24)25/h3,5,7,15,18,21H,4,6,8-13H2,1-2H3/t15-,18+/m0/s1 |
| InChIKey | ZSWBAWMAHYFGFR-MAUKXSAKSA-N |
| XLogP | 1.47 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |