C21H22ClN3O3 — CID 110144015
[(4aS,10bS)-9-chlorospiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine]-1'-yl]-pyridazin-3-ylmethanone (PubChem CID 110144015) has the molecular formula C21H22ClN3O3 and a molecular weight of 399.88 g/mol. Its IUPAC name is [(4aS,10bS)-9-chlorospiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine]-1'-yl]-pyridazin-3-ylmethanone.
| Compound Name | [(4aS,10bS)-9-chlorospiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine]-1'-yl]-pyridazin-3-ylmethanone |
|---|---|
| PubChem CID | 110144015 |
| Molecular Formula | C21H22ClN3O3 |
| Molecular Weight | 399.88 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | [(4aS,10bS)-9-chlorospiro[3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-5,4'-piperidine]-1'-yl]-pyridazin-3-ylmethanone |
| SMILES | O=C(c1cccnn1)N1CCC2(CC1)Oc1ccc(Cl)cc1[C@H]1OCCC[C@@H]12 |
| InChI | InChI=1S/C21H22ClN3O3/c22-14-5-6-18-15(13-14)19-16(3-2-12-27-19)21(28-18)7-10-25(11-8-21)20(26)17-4-1-9-23-24-17/h1,4-6,9,13,16,19H,2-3,7-8,10-12H2/t16-,19+/m0/s1 |
| InChIKey | WOQMVGIKHXNBRY-QFBILLFUSA-N |
| XLogP | 3.67 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.88 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |