C23H29ClNO2+ — CID 7529793
(1R,4aS,8aS)-2-[(2-chlorophenyl)methyl]-1-(2-methoxyphenyl)-2,3,4,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ium-4a-ol (PubChem CID 7529793) has the molecular formula C23H29ClNO2+ and a molecular weight of 386.94 g/mol. Its IUPAC name is (1R,4aS,8aS)-2-[(2-chlorophenyl)methyl]-1-(2-methoxyphenyl)-2,3,4,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ium-4a-ol.
| Compound Name | (1R,4aS,8aS)-2-[(2-chlorophenyl)methyl]-1-(2-methoxyphenyl)-2,3,4,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ium-4a-ol |
|---|---|
| PubChem CID | 7529793 |
| Molecular Formula | C23H29ClNO2+ |
| Molecular Weight | 386.94 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | (1R,4aS,8aS)-2-[(2-chlorophenyl)methyl]-1-(2-methoxyphenyl)-2,3,4,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ium-4a-ol |
| SMILES | COc1ccccc1[C@H]1[C@@H]2CCCC[C@]2(O)CC[NH+]1Cc1ccccc1Cl |
| InChI | InChI=1S/C23H28ClNO2/c1-27-21-12-5-3-9-18(21)22-19-10-6-7-13-23(19,26)14-15-25(22)16-17-8-2-4-11-20(17)24/h2-5,8-9,11-12,19,22,26H,6-7,10,13-16H2,1H3/p+1/t19-,22-,23-/m0/s1 |
| InChIKey | BUZOOTVRWDNERF-VJBMBRPKSA-O |
| XLogP | 3.80 |
| TPSA | 33.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.94 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |