C26H36ClN2O+ — CID 6586688
(1R,4aR,8aR)-2-[(2-chlorophenyl)methyl]-1-[4-(diethylamino)phenyl]-2,3,4,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ium-4a-ol (PubChem CID 6586688) has the molecular formula C26H36ClN2O+ and a molecular weight of 428.04 g/mol. Its IUPAC name is (1R,4aR,8aR)-2-[(2-chlorophenyl)methyl]-1-[4-(diethylamino)phenyl]-2,3,4,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ium-4a-ol.
| Compound Name | (1R,4aR,8aR)-2-[(2-chlorophenyl)methyl]-1-[4-(diethylamino)phenyl]-2,3,4,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ium-4a-ol |
|---|---|
| PubChem CID | 6586688 |
| Molecular Formula | C26H36ClN2O+ |
| Molecular Weight | 428.04 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | (1R,4aR,8aR)-2-[(2-chlorophenyl)methyl]-1-[4-(diethylamino)phenyl]-2,3,4,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ium-4a-ol |
| SMILES | CCN(CC)c1ccc([C@H]2[C@H]3CCCC[C@@]3(O)CC[NH+]2Cc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C26H35ClN2O/c1-3-28(4-2)22-14-12-20(13-15-22)25-23-10-7-8-16-26(23,30)17-18-29(25)19-21-9-5-6-11-24(21)27/h5-6,9,11-15,23,25,30H,3-4,7-8,10,16-19H2,1-2H3/p+1/t23-,25+,26-/m1/s1 |
| InChIKey | FHTHNPSINGICMV-DMTNHVFBSA-O |
| XLogP | 4.64 |
| TPSA | 27.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.04 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|