C23H29FNO2+ — CID 7528476
(1S,4aS,8aR)-2-[(3-fluorophenyl)methyl]-1-(4-methoxyphenyl)-2,3,4,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ium-4a-ol (PubChem CID 7528476) has the molecular formula C23H29FNO2+ and a molecular weight of 370.49 g/mol. Its IUPAC name is (1S,4aS,8aR)-2-[(3-fluorophenyl)methyl]-1-(4-methoxyphenyl)-2,3,4,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ium-4a-ol.
| Compound Name | (1S,4aS,8aR)-2-[(3-fluorophenyl)methyl]-1-(4-methoxyphenyl)-2,3,4,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ium-4a-ol |
|---|---|
| PubChem CID | 7528476 |
| Molecular Formula | C23H29FNO2+ |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | (1S,4aS,8aR)-2-[(3-fluorophenyl)methyl]-1-(4-methoxyphenyl)-2,3,4,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ium-4a-ol |
| SMILES | COc1ccc([C@@H]2[C@H]3CCCC[C@]3(O)CC[NH+]2Cc2cccc(F)c2)cc1 |
| InChI | InChI=1S/C23H28FNO2/c1-27-20-10-8-18(9-11-20)22-21-7-2-3-12-23(21,26)13-14-25(22)16-17-5-4-6-19(24)15-17/h4-6,8-11,15,21-22,26H,2-3,7,12-14,16H2,1H3/p+1/t21-,22-,23+/m1/s1 |
| InChIKey | UVOCKBWJADXADZ-ZLNRFVROSA-O |
| XLogP | 3.29 |
| TPSA | 33.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |