C23H28FNO2 — CID 2009858
(1R,4aR,8aS)-2-[(3-fluorophenyl)methyl]-1-(4-methoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol (PubChem CID 2009858) has the molecular formula C23H28FNO2 and a molecular weight of 369.48 g/mol. Its IUPAC name is (1R,4aR,8aS)-2-[(3-fluorophenyl)methyl]-1-(4-methoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol.
| Compound Name | (1R,4aR,8aS)-2-[(3-fluorophenyl)methyl]-1-(4-methoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
|---|---|
| PubChem CID | 2009858 |
| Molecular Formula | C23H28FNO2 |
| Molecular Weight | 369.48 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | (1R,4aR,8aS)-2-[(3-fluorophenyl)methyl]-1-(4-methoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
| SMILES | COc1ccc([C@H]2[C@@H]3CCCC[C@@]3(O)CCN2Cc2cccc(F)c2)cc1 |
| InChI | InChI=1S/C23H28FNO2/c1-27-20-10-8-18(9-11-20)22-21-7-2-3-12-23(21,26)13-14-25(22)16-17-5-4-6-19(24)15-17/h4-6,8-11,15,21-22,26H,2-3,7,12-14,16H2,1H3/t21-,22-,23+/m0/s1 |
| InChIKey | UVOCKBWJADXADZ-RJGXRXQPSA-N |
| XLogP | 4.70 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.48 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |