C18H25N2O2+ — CID 7537878
2-[(1S,4aS,8aS)-4a-hydroxy-1-(4-methoxyphenyl)-2,3,4,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ium-2-yl]acetonitrile (PubChem CID 7537878) has the molecular formula C18H25N2O2+ and a molecular weight of 301.41 g/mol. Its IUPAC name is 2-[(1S,4aS,8aS)-4a-hydroxy-1-(4-methoxyphenyl)-2,3,4,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ium-2-yl]acetonitrile.
| Compound Name | 2-[(1S,4aS,8aS)-4a-hydroxy-1-(4-methoxyphenyl)-2,3,4,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ium-2-yl]acetonitrile |
|---|---|
| PubChem CID | 7537878 |
| Molecular Formula | C18H25N2O2+ |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | 2-[(1S,4aS,8aS)-4a-hydroxy-1-(4-methoxyphenyl)-2,3,4,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ium-2-yl]acetonitrile |
| SMILES | COc1ccc([C@@H]2[C@@H]3CCCC[C@]3(O)CC[NH+]2CC#N)cc1 |
| InChI | InChI=1S/C18H24N2O2/c1-22-15-7-5-14(6-8-15)17-16-4-2-3-9-18(16,21)10-12-20(17)13-11-19/h5-8,16-17,21H,2-4,9-10,12-13H2,1H3/p+1/t16-,17+,18-/m0/s1 |
| InChIKey | FMBWXWJAWGGINB-KSZLIROESA-O |
| XLogP | 1.47 |
| TPSA | 57.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|