C26H35N2O3+ — CID 2005511
2-[(1S,4aR,8aR)-4a-hydroxy-1-(4-methoxyphenyl)-2,3,4,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ium-2-yl]-N-(2,5-dimethylphenyl)acetamide (PubChem CID 2005511) has the molecular formula C26H35N2O3+ and a molecular weight of 423.58 g/mol. Its IUPAC name is 2-[(1S,4aR,8aR)-4a-hydroxy-1-(4-methoxyphenyl)-2,3,4,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ium-2-yl]-N-(2,5-dimethylphenyl)acetamide.
| Compound Name | 2-[(1S,4aR,8aR)-4a-hydroxy-1-(4-methoxyphenyl)-2,3,4,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ium-2-yl]-N-(2,5-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 2005511 |
| Molecular Formula | C26H35N2O3+ |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.26 |
| IUPAC Name | 2-[(1S,4aR,8aR)-4a-hydroxy-1-(4-methoxyphenyl)-2,3,4,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ium-2-yl]-N-(2,5-dimethylphenyl)acetamide |
| SMILES | COc1ccc([C@@H]2[C@H]3CCCC[C@@]3(O)CC[NH+]2CC(=O)Nc2cc(C)ccc2C)cc1 |
| InChI | InChI=1S/C26H34N2O3/c1-18-7-8-19(2)23(16-18)27-24(29)17-28-15-14-26(30)13-5-4-6-22(26)25(28)20-9-11-21(31-3)12-10-20/h7-12,16,22,25,30H,4-6,13-15,17H2,1-3H3,(H,27,29)/p+1/t22-,25-,26-/m1/s1 |
| InChIKey | QMRMWHQBABTUIB-DNRSQYFGSA-O |
| XLogP | 3.20 |
| TPSA | 63.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |