C23H37N2O4+ — CID 11907716
2-[(1R,4aR,8aR)-1-(2,5-dimethoxyphenyl)-4a-hydroxy-2,3,4,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ium-2-yl]-N-butylacetamide (PubChem CID 11907716) has the molecular formula C23H37N2O4+ and a molecular weight of 405.56 g/mol. Its IUPAC name is 2-[(1R,4aR,8aR)-1-(2,5-dimethoxyphenyl)-4a-hydroxy-2,3,4,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ium-2-yl]-N-butylacetamide.
| Compound Name | 2-[(1R,4aR,8aR)-1-(2,5-dimethoxyphenyl)-4a-hydroxy-2,3,4,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ium-2-yl]-N-butylacetamide |
|---|---|
| PubChem CID | 11907716 |
| Molecular Formula | C23H37N2O4+ |
| Molecular Weight | 405.56 g/mol |
| Exact Mass | 405.27 |
| IUPAC Name | 2-[(1R,4aR,8aR)-1-(2,5-dimethoxyphenyl)-4a-hydroxy-2,3,4,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ium-2-yl]-N-butylacetamide |
| SMILES | CCCCNC(=O)C[NH+]1CC[C@]2(O)CCCC[C@@H]2[C@@H]1c1cc(OC)ccc1OC |
| InChI | InChI=1S/C23H36N2O4/c1-4-5-13-24-21(26)16-25-14-12-23(27)11-7-6-8-19(23)22(25)18-15-17(28-2)9-10-20(18)29-3/h9-10,15,19,22,27H,4-8,11-14,16H2,1-3H3,(H,24,26)/p+1/t19-,22+,23-/m1/s1 |
| InChIKey | QUMWUHGCJYLWBL-WTIAFYNJSA-O |
| XLogP | 1.87 |
| TPSA | 72.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.56 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|