C27H44N2O4 — CID 125407333
2-[(1R,4aR,8aS)-1-(2,5-dimethoxyphenyl)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-N-[(2S)-2-ethylhexyl]acetamide (PubChem CID 125407333) has the molecular formula C27H44N2O4 and a molecular weight of 460.66 g/mol. Its IUPAC name is 2-[(1R,4aR,8aS)-1-(2,5-dimethoxyphenyl)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-N-[(2S)-2-ethylhexyl]acetamide.
| Compound Name | 2-[(1R,4aR,8aS)-1-(2,5-dimethoxyphenyl)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-N-[(2S)-2-ethylhexyl]acetamide |
|---|---|
| PubChem CID | 125407333 |
| Molecular Formula | C27H44N2O4 |
| Molecular Weight | 460.66 g/mol |
| Exact Mass | 460.33 |
| IUPAC Name | 2-[(1R,4aR,8aS)-1-(2,5-dimethoxyphenyl)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-N-[(2S)-2-ethylhexyl]acetamide |
| SMILES | CCCC[C@H](CC)CNC(=O)CN1CC[C@]2(O)CCCC[C@H]2[C@@H]1c1cc(OC)ccc1OC |
| InChI | InChI=1S/C27H44N2O4/c1-5-7-10-20(6-2)18-28-25(30)19-29-16-15-27(31)14-9-8-11-23(27)26(29)22-17-21(32-3)12-13-24(22)33-4/h12-13,17,20,23,26,31H,5-11,14-16,18-19H2,1-4H3,(H,28,30)/t20-,23-,26-,27+/m0/s1 |
| InChIKey | BACBBWRARCHFCT-VPGCXLQWSA-N |
| XLogP | 4.70 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.66 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |