C24H38N2O5 — CID 7001041
2-[(1R,4aR,8aS)-4a-hydroxy-1-(3,4,5-trimethoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-N-butylacetamide (PubChem CID 7001041) has the molecular formula C24H38N2O5 and a molecular weight of 434.58 g/mol. Its IUPAC name is 2-[(1R,4aR,8aS)-4a-hydroxy-1-(3,4,5-trimethoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-N-butylacetamide.
| Compound Name | 2-[(1R,4aR,8aS)-4a-hydroxy-1-(3,4,5-trimethoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-N-butylacetamide |
|---|---|
| PubChem CID | 7001041 |
| Molecular Formula | C24H38N2O5 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.28 |
| IUPAC Name | 2-[(1R,4aR,8aS)-4a-hydroxy-1-(3,4,5-trimethoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-N-butylacetamide |
| SMILES | CCCCNC(=O)CN1CC[C@]2(O)CCCC[C@H]2[C@@H]1c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C24H38N2O5/c1-5-6-12-25-21(27)16-26-13-11-24(28)10-8-7-9-18(24)22(26)17-14-19(29-2)23(31-4)20(15-17)30-3/h14-15,18,22,28H,5-13,16H2,1-4H3,(H,25,27)/t18-,22-,24+/m0/s1 |
| InChIKey | MSJJTVWAATYDKJ-JKFKMHIGSA-N |
| XLogP | 3.30 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|