C30H36N2O5 — CID 51705194
2-[(1S,4aS,8aS)-4a-hydroxy-1-(3,4,5-trimethoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-N-naphthalen-1-ylacetamide (PubChem CID 51705194) has the molecular formula C30H36N2O5 and a molecular weight of 504.63 g/mol. Its IUPAC name is 2-[(1S,4aS,8aS)-4a-hydroxy-1-(3,4,5-trimethoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-N-naphthalen-1-ylacetamide.
| Compound Name | 2-[(1S,4aS,8aS)-4a-hydroxy-1-(3,4,5-trimethoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-N-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 51705194 |
| Molecular Formula | C30H36N2O5 |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.26 |
| IUPAC Name | 2-[(1S,4aS,8aS)-4a-hydroxy-1-(3,4,5-trimethoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-N-naphthalen-1-ylacetamide |
| SMILES | COc1cc([C@@H]2[C@@H]3CCCC[C@]3(O)CCN2CC(=O)Nc2cccc3ccccc23)cc(OC)c1OC |
| InChI | InChI=1S/C30H36N2O5/c1-35-25-17-21(18-26(36-2)29(25)37-3)28-23-12-6-7-14-30(23,34)15-16-32(28)19-27(33)31-24-13-8-10-20-9-4-5-11-22(20)24/h4-5,8-11,13,17-18,23,28,34H,6-7,12,14-16,19H2,1-3H3,(H,31,33)/t23-,28+,30-/m0/s1 |
| InChIKey | MKOVLHWHLGIGET-ZSNHWWIQSA-N |
| XLogP | 5.17 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |