C25H32N2O5 — CID 127254235
2-[(1R)-4a-hydroxy-1-(4-hydroxy-3-methoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-N-(4-methoxyphenyl)acetamide (PubChem CID 127254235) has the molecular formula C25H32N2O5 and a molecular weight of 440.54 g/mol. Its IUPAC name is 2-[(1R)-4a-hydroxy-1-(4-hydroxy-3-methoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[(1R)-4a-hydroxy-1-(4-hydroxy-3-methoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 127254235 |
| Molecular Formula | C25H32N2O5 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | 2-[(1R)-4a-hydroxy-1-(4-hydroxy-3-methoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)CN2CCC3(O)CCCCC3[C@@H]2c2ccc(O)c(OC)c2)cc1 |
| InChI | InChI=1S/C25H32N2O5/c1-31-19-9-7-18(8-10-19)26-23(29)16-27-14-13-25(30)12-4-3-5-20(25)24(27)17-6-11-21(28)22(15-17)32-2/h6-11,15,20,24,28,30H,3-5,12-14,16H2,1-2H3,(H,26,29)/t20?,24-,25?/m0/s1 |
| InChIKey | SNTJTEVKGUJQCL-SILAFFCESA-N |
| XLogP | 3.72 |
| TPSA | 91.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |