C26H34N2O5 — CID 26917775
2-[(1R,4aR,8aS)-4a-hydroxy-1-(3,4,5-trimethoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-N-phenylacetamide (PubChem CID 26917775) has the molecular formula C26H34N2O5 and a molecular weight of 454.57 g/mol. Its IUPAC name is 2-[(1R,4aR,8aS)-4a-hydroxy-1-(3,4,5-trimethoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-N-phenylacetamide.
| Compound Name | 2-[(1R,4aR,8aS)-4a-hydroxy-1-(3,4,5-trimethoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 26917775 |
| Molecular Formula | C26H34N2O5 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | 2-[(1R,4aR,8aS)-4a-hydroxy-1-(3,4,5-trimethoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-N-phenylacetamide |
| SMILES | COc1cc([C@H]2[C@@H]3CCCC[C@@]3(O)CCN2CC(=O)Nc2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C26H34N2O5/c1-31-21-15-18(16-22(32-2)25(21)33-3)24-20-11-7-8-12-26(20,30)13-14-28(24)17-23(29)27-19-9-5-4-6-10-19/h4-6,9-10,15-16,20,24,30H,7-8,11-14,17H2,1-3H3,(H,27,29)/t20-,24-,26+/m0/s1 |
| InChIKey | UCEGJTAQUBKYER-OCDQVXHZSA-N |
| XLogP | 4.02 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |