C27H34N2O4 — CID 98359272
2-[(1S,4aS,8aR)-4a-hydroxy-1-(4-prop-2-enoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-N-(4-methoxyphenyl)acetamide (PubChem CID 98359272) has the molecular formula C27H34N2O4 and a molecular weight of 450.58 g/mol. Its IUPAC name is 2-[(1S,4aS,8aR)-4a-hydroxy-1-(4-prop-2-enoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[(1S,4aS,8aR)-4a-hydroxy-1-(4-prop-2-enoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 98359272 |
| Molecular Formula | C27H34N2O4 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | 2-[(1S,4aS,8aR)-4a-hydroxy-1-(4-prop-2-enoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-N-(4-methoxyphenyl)acetamide |
| SMILES | C=CCOc1ccc([C@@H]2[C@H]3CCCC[C@]3(O)CCN2CC(=O)Nc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C27H34N2O4/c1-3-18-33-23-11-7-20(8-12-23)26-24-6-4-5-15-27(24,31)16-17-29(26)19-25(30)28-21-9-13-22(32-2)14-10-21/h3,7-14,24,26,31H,1,4-6,15-19H2,2H3,(H,28,30)/t24-,26-,27+/m1/s1 |
| InChIKey | FAGWXHRYXJSUFW-IEUSDUHPSA-N |
| XLogP | 4.57 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|