C23H34N2O4 — CID 127254135
2-[(1R)-1-(1,3-benzodioxol-5-yl)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-N-pentylacetamide (PubChem CID 127254135) has the molecular formula C23H34N2O4 and a molecular weight of 402.54 g/mol. Its IUPAC name is 2-[(1R)-1-(1,3-benzodioxol-5-yl)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-N-pentylacetamide.
| Compound Name | 2-[(1R)-1-(1,3-benzodioxol-5-yl)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-N-pentylacetamide |
|---|---|
| PubChem CID | 127254135 |
| Molecular Formula | C23H34N2O4 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.25 |
| IUPAC Name | 2-[(1R)-1-(1,3-benzodioxol-5-yl)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-N-pentylacetamide |
| SMILES | CCCCCNC(=O)CN1CCC2(O)CCCCC2[C@@H]1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C23H34N2O4/c1-2-3-6-12-24-21(26)15-25-13-11-23(27)10-5-4-7-18(23)22(25)17-8-9-19-20(14-17)29-16-28-19/h8-9,14,18,22,27H,2-7,10-13,15-16H2,1H3,(H,24,26)/t18?,22-,23?/m0/s1 |
| InChIKey | XFEVYGOFGKAHNI-PHBIXPCASA-N |
| XLogP | 3.39 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|