C28H36N2O6 — CID 124825551
ethyl 2-[[2-[(1S,4aR,8aR)-1-(2,5-dimethoxyphenyl)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]acetyl]amino]benzoate (PubChem CID 124825551) has the molecular formula C28H36N2O6 and a molecular weight of 496.60 g/mol. Its IUPAC name is ethyl 2-[[2-[(1S,4aR,8aR)-1-(2,5-dimethoxyphenyl)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 2-[[2-[(1S,4aR,8aR)-1-(2,5-dimethoxyphenyl)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 124825551 |
| Molecular Formula | C28H36N2O6 |
| Molecular Weight | 496.60 g/mol |
| Exact Mass | 496.26 |
| IUPAC Name | ethyl 2-[[2-[(1S,4aR,8aR)-1-(2,5-dimethoxyphenyl)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)CN1CC[C@]2(O)CCCC[C@@H]2[C@H]1c1cc(OC)ccc1OC |
| InChI | InChI=1S/C28H36N2O6/c1-4-36-27(32)20-9-5-6-11-23(20)29-25(31)18-30-16-15-28(33)14-8-7-10-22(28)26(30)21-17-19(34-2)12-13-24(21)35-3/h5-6,9,11-13,17,22,26,33H,4,7-8,10,14-16,18H2,1-3H3,(H,29,31)/t22-,26-,28-/m1/s1 |
| InChIKey | CYJDOTYHYSUICT-DUFKRMHYSA-N |
| XLogP | 4.19 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.60 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |