C25H30Cl2N2O4 — CID 2011088
2-[(1R,4aS,8aS)-1-(2,4-dimethoxyphenyl)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-N-(2,4-dichlorophenyl)acetamide (PubChem CID 2011088) has the molecular formula C25H30Cl2N2O4 and a molecular weight of 493.43 g/mol. Its IUPAC name is 2-[(1R,4aS,8aS)-1-(2,4-dimethoxyphenyl)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-N-(2,4-dichlorophenyl)acetamide.
| Compound Name | 2-[(1R,4aS,8aS)-1-(2,4-dimethoxyphenyl)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-N-(2,4-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 2011088 |
| Molecular Formula | C25H30Cl2N2O4 |
| Molecular Weight | 493.43 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | 2-[(1R,4aS,8aS)-1-(2,4-dimethoxyphenyl)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-N-(2,4-dichlorophenyl)acetamide |
| SMILES | COc1ccc([C@H]2[C@@H]3CCCC[C@]3(O)CCN2CC(=O)Nc2ccc(Cl)cc2Cl)c(OC)c1 |
| InChI | InChI=1S/C25H30Cl2N2O4/c1-32-17-7-8-18(22(14-17)33-2)24-19-5-3-4-10-25(19,31)11-12-29(24)15-23(30)28-21-9-6-16(26)13-20(21)27/h6-9,13-14,19,24,31H,3-5,10-12,15H2,1-2H3,(H,28,30)/t19-,24-,25-/m0/s1 |
| InChIKey | LDXVWFULKHKEMT-LQGLAIQGSA-N |
| XLogP | 5.32 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.43 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |