C24H32N2O5 — CID 4555854
2-[1-(2,4-dimethoxyphenyl)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-N-(furan-2-ylmethyl)acetamide (PubChem CID 4555854) has the molecular formula C24H32N2O5 and a molecular weight of 428.53 g/mol. Its IUPAC name is 2-[1-(2,4-dimethoxyphenyl)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-N-(furan-2-ylmethyl)acetamide.
| Compound Name | 2-[1-(2,4-dimethoxyphenyl)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 4555854 |
| Molecular Formula | C24H32N2O5 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | 2-[1-(2,4-dimethoxyphenyl)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-N-(furan-2-ylmethyl)acetamide |
| SMILES | COc1ccc(C2C3CCCCC3(O)CCN2CC(=O)NCc2ccco2)c(OC)c1 |
| InChI | InChI=1S/C24H32N2O5/c1-29-17-8-9-19(21(14-17)30-2)23-20-7-3-4-10-24(20,28)11-12-26(23)16-22(27)25-15-18-6-5-13-31-18/h5-6,8-9,13-14,20,23,28H,3-4,7,10-12,15-16H2,1-2H3,(H,25,27) |
| InChIKey | JVQXUZLBJSBYEW-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 84.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |