C26H33NO3 — CID 127254244
(1R)-1-(2,5-dimethoxyphenyl)-2-[(E)-3-phenylprop-2-enyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol (PubChem CID 127254244) has the molecular formula C26H33NO3 and a molecular weight of 407.55 g/mol. Its IUPAC name is (1R)-1-(2,5-dimethoxyphenyl)-2-[(E)-3-phenylprop-2-enyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol.
| Compound Name | (1R)-1-(2,5-dimethoxyphenyl)-2-[(E)-3-phenylprop-2-enyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
|---|---|
| PubChem CID | 127254244 |
| Molecular Formula | C26H33NO3 |
| Molecular Weight | 407.55 g/mol |
| Exact Mass | 407.25 |
| IUPAC Name | (1R)-1-(2,5-dimethoxyphenyl)-2-[(E)-3-phenylprop-2-enyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
| SMILES | COc1ccc(OC)c([C@H]2C3CCCCC3(O)CCN2C/C=C/c2ccccc2)c1 |
| InChI | InChI=1S/C26H33NO3/c1-29-21-13-14-24(30-2)22(19-21)25-23-12-6-7-15-26(23,28)16-18-27(25)17-8-11-20-9-4-3-5-10-20/h3-5,8-11,13-14,19,23,25,28H,6-7,12,15-18H2,1-2H3/b11-8+/t23?,25-,26?/m0/s1 |
| InChIKey | NGTYIDRNJTUKEY-RPWBMNMVSA-N |
| XLogP | 5.09 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.55 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |