C24H31FNO3+ — CID 7529394
(1R,4aS,8aS)-1-(3,4-dimethoxyphenyl)-2-[(3-fluorophenyl)methyl]-2,3,4,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ium-4a-ol (PubChem CID 7529394) has the molecular formula C24H31FNO3+ and a molecular weight of 400.51 g/mol. Its IUPAC name is (1R,4aS,8aS)-1-(3,4-dimethoxyphenyl)-2-[(3-fluorophenyl)methyl]-2,3,4,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ium-4a-ol.
| Compound Name | (1R,4aS,8aS)-1-(3,4-dimethoxyphenyl)-2-[(3-fluorophenyl)methyl]-2,3,4,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ium-4a-ol |
|---|---|
| PubChem CID | 7529394 |
| Molecular Formula | C24H31FNO3+ |
| Molecular Weight | 400.51 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | (1R,4aS,8aS)-1-(3,4-dimethoxyphenyl)-2-[(3-fluorophenyl)methyl]-2,3,4,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ium-4a-ol |
| SMILES | COc1ccc([C@H]2[C@@H]3CCCC[C@]3(O)CC[NH+]2Cc2cccc(F)c2)cc1OC |
| InChI | InChI=1S/C24H30FNO3/c1-28-21-10-9-18(15-22(21)29-2)23-20-8-3-4-11-24(20,27)12-13-26(23)16-17-6-5-7-19(25)14-17/h5-7,9-10,14-15,20,23,27H,3-4,8,11-13,16H2,1-2H3/p+1/t20-,23-,24-/m0/s1 |
| InChIKey | FKRPXPXSMAVQSM-OYDLWJJNSA-O |
| XLogP | 3.29 |
| TPSA | 43.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.51 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |