C24H31ClNO3+ — CID 2044040
(1R,4aS,8aS)-2-[(2-chlorophenyl)methyl]-1-(3,4-dimethoxyphenyl)-2,3,4,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ium-4a-ol (PubChem CID 2044040) has the molecular formula C24H31ClNO3+ and a molecular weight of 416.97 g/mol. Its IUPAC name is (1R,4aS,8aS)-2-[(2-chlorophenyl)methyl]-1-(3,4-dimethoxyphenyl)-2,3,4,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ium-4a-ol.
| Compound Name | (1R,4aS,8aS)-2-[(2-chlorophenyl)methyl]-1-(3,4-dimethoxyphenyl)-2,3,4,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ium-4a-ol |
|---|---|
| PubChem CID | 2044040 |
| Molecular Formula | C24H31ClNO3+ |
| Molecular Weight | 416.97 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | (1R,4aS,8aS)-2-[(2-chlorophenyl)methyl]-1-(3,4-dimethoxyphenyl)-2,3,4,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ium-4a-ol |
| SMILES | COc1ccc([C@H]2[C@@H]3CCCC[C@]3(O)CC[NH+]2Cc2ccccc2Cl)cc1OC |
| InChI | InChI=1S/C24H30ClNO3/c1-28-21-11-10-17(15-22(21)29-2)23-19-8-5-6-12-24(19,27)13-14-26(23)16-18-7-3-4-9-20(18)25/h3-4,7,9-11,15,19,23,27H,5-6,8,12-14,16H2,1-2H3/p+1/t19-,23-,24-/m0/s1 |
| InChIKey | SCUTXQRXFFYAIA-IGKWTDBASA-O |
| XLogP | 3.81 |
| TPSA | 43.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.97 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |