C24H31ClNO2+ — CID 7093914
(1R,4aS,8aR)-2-[(2-chlorophenyl)methyl]-1-(2-ethoxyphenyl)-2,3,4,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ium-4a-ol (PubChem CID 7093914) has the molecular formula C24H31ClNO2+ and a molecular weight of 400.97 g/mol. Its IUPAC name is (1R,4aS,8aR)-2-[(2-chlorophenyl)methyl]-1-(2-ethoxyphenyl)-2,3,4,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ium-4a-ol.
| Compound Name | (1R,4aS,8aR)-2-[(2-chlorophenyl)methyl]-1-(2-ethoxyphenyl)-2,3,4,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ium-4a-ol |
|---|---|
| PubChem CID | 7093914 |
| Molecular Formula | C24H31ClNO2+ |
| Molecular Weight | 400.97 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | (1R,4aS,8aR)-2-[(2-chlorophenyl)methyl]-1-(2-ethoxyphenyl)-2,3,4,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ium-4a-ol |
| SMILES | CCOc1ccccc1[C@H]1[C@H]2CCCC[C@]2(O)CC[NH+]1Cc1ccccc1Cl |
| InChI | InChI=1S/C24H30ClNO2/c1-2-28-22-13-6-4-10-19(22)23-20-11-7-8-14-24(20,27)15-16-26(23)17-18-9-3-5-12-21(18)25/h3-6,9-10,12-13,20,23,27H,2,7-8,11,14-17H2,1H3/p+1/t20-,23+,24+/m1/s1 |
| InChIKey | CGAXGIVILAYNDK-QDSKXPNFSA-O |
| XLogP | 4.19 |
| TPSA | 33.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.97 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |